pristanic acid


pristanic acid
Links:🌍 Wikipedia, 🕷 ChemSpider
CAS RN:[1189-37-3]
Formula:C19H38O2; 298.51 g/mol
InChiKey:PAHGJZDQXIOYTH-UHFFFAOYSA-N
SMILES:CC(C)CCCC(C)CCCC(C)CCCC(C)C(O)=O
Molecular structure of pristanic acid

Isomers

ethyl heptadecanoate
Molecular structure of ethyl heptadecanoate
glycidyl hexadecyl ether
Molecular structure of glycidyl hexadecyl ether
methyl octadecanoate
Molecular structure of methyl octadecanoate
nonadecanoic acid
Molecular structure of nonadecanoic acid
pristanic acid
Molecular structure of pristanic acid
propan-2-yl hexadecanoate
Molecular structure of propan-2-yl hexadecanoate
propyl hexadecanoate
Molecular structure of propyl hexadecanoate